C22H20ClNOS — CID 5127187
N-[(2-chlorophenyl)methyl]-4-[(4-methylphenyl)sulfanylmethyl]benzamide (PubChem CID 5127187) has the molecular formula C22H20ClNOS and a molecular weight of 381.93 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]-4-[(4-methylphenyl)sulfanylmethyl]benzamide.
| Compound Name | N-[(2-chlorophenyl)methyl]-4-[(4-methylphenyl)sulfanylmethyl]benzamide |
|---|---|
| PubChem CID | 5127187 |
| Molecular Formula | C22H20ClNOS |
| Molecular Weight | 381.93 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]-4-[(4-methylphenyl)sulfanylmethyl]benzamide |
| SMILES | Cc1ccc(SCc2ccc(C(=O)NCc3ccccc3Cl)cc2)cc1 |
| InChI | InChI=1S/C22H20ClNOS/c1-16-6-12-20(13-7-16)26-15-17-8-10-18(11-9-17)22(25)24-14-19-4-2-3-5-21(19)23/h2-13H,14-15H2,1H3,(H,24,25) |
| InChIKey | SIPRXGUPNRWAPW-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.93 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |