C14H13BClNO3 — CID 138991708
[4-[(2-chlorophenyl)methylcarbamoyl]phenyl]boronic acid (PubChem CID 138991708) has the molecular formula C14H13BClNO3 and a molecular weight of 289.53 g/mol. Its IUPAC name is [4-[(2-chlorophenyl)methylcarbamoyl]phenyl]boronic acid.
| Compound Name | [4-[(2-chlorophenyl)methylcarbamoyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 138991708 |
| Molecular Formula | C14H13BClNO3 |
| Molecular Weight | 289.53 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | [4-[(2-chlorophenyl)methylcarbamoyl]phenyl]boronic acid |
| SMILES | O=C(NCc1ccccc1Cl)c1ccc(B(O)O)cc1 |
| InChI | InChI=1S/C14H13BClNO3/c16-13-4-2-1-3-11(13)9-17-14(18)10-5-7-12(8-6-10)15(19)20/h1-8,19-20H,9H2,(H,17,18) |
| InChIKey | YRKLVXMKCMVKAZ-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.53 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|