C15H8Cl5NO3 — CID 134114216
2,3,4,5-tetrachloro-6-[(2-chlorophenyl)methylcarbamoyl]benzoic acid (PubChem CID 134114216) has the molecular formula C15H8Cl5NO3 and a molecular weight of 427.50 g/mol. Its IUPAC name is 2,3,4,5-tetrachloro-6-[(2-chlorophenyl)methylcarbamoyl]benzoic acid.
| Compound Name | 2,3,4,5-tetrachloro-6-[(2-chlorophenyl)methylcarbamoyl]benzoic acid |
|---|---|
| PubChem CID | 134114216 |
| Molecular Formula | C15H8Cl5NO3 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 424.89 |
| IUPAC Name | 2,3,4,5-tetrachloro-6-[(2-chlorophenyl)methylcarbamoyl]benzoic acid |
| SMILES | O=C(O)c1c(Cl)c(Cl)c(Cl)c(Cl)c1C(=O)NCc1ccccc1Cl |
| InChI | InChI=1S/C15H8Cl5NO3/c16-7-4-2-1-3-6(7)5-21-14(22)8-9(15(23)24)11(18)13(20)12(19)10(8)17/h1-4H,5H2,(H,21,22)(H,23,24) |
| InChIKey | GDQORHBZTMMBHE-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|