C18H19NO — CID 19365215
4-methyl-N-(1-phenylbut-3-en-2-yl)benzamide (PubChem CID 19365215) has the molecular formula C18H19NO and a molecular weight of 265.36 g/mol. Its IUPAC name is 4-methyl-N-(1-phenylbut-3-en-2-yl)benzamide.
| Compound Name | 4-methyl-N-(1-phenylbut-3-en-2-yl)benzamide |
|---|---|
| PubChem CID | 19365215 |
| Molecular Formula | C18H19NO |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | 4-methyl-N-(1-phenylbut-3-en-2-yl)benzamide |
| SMILES | C=CC(Cc1ccccc1)NC(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C18H19NO/c1-3-17(13-15-7-5-4-6-8-15)19-18(20)16-11-9-14(2)10-12-16/h3-12,17H,1,13H2,2H3,(H,19,20) |
| InChIKey | XMKDURWBUOYWCX-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|