C23H19NO3 — CID 20666681
4-benzoyl-N-[(2S)-1-oxo-3-phenylpropan-2-yl]benzamide (PubChem CID 20666681) has the molecular formula C23H19NO3 and a molecular weight of 357.41 g/mol. Its IUPAC name is 4-benzoyl-N-[(2S)-1-oxo-3-phenylpropan-2-yl]benzamide.
| Compound Name | 4-benzoyl-N-[(2S)-1-oxo-3-phenylpropan-2-yl]benzamide |
|---|---|
| PubChem CID | 20666681 |
| Molecular Formula | C23H19NO3 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | 4-benzoyl-N-[(2S)-1-oxo-3-phenylpropan-2-yl]benzamide |
| SMILES | O=C[C@H](Cc1ccccc1)NC(=O)c1ccc(C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H19NO3/c25-16-21(15-17-7-3-1-4-8-17)24-23(27)20-13-11-19(12-14-20)22(26)18-9-5-2-6-10-18/h1-14,16,21H,15H2,(H,24,27)/t21-/m0/s1 |
| InChIKey | BBXNRPPKLGQVDJ-NRFANRHFSA-N |
| XLogP | 3.46 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|