C28H23NO2 — CID 173276331
3-(2-naphthalen-2-ylethenyl)-N-(1-oxo-3-phenylpropan-2-yl)benzamide (PubChem CID 173276331) has the molecular formula C28H23NO2 and a molecular weight of 405.50 g/mol. Its IUPAC name is 3-(2-naphthalen-2-ylethenyl)-N-(1-oxo-3-phenylpropan-2-yl)benzamide.
| Compound Name | 3-(2-naphthalen-2-ylethenyl)-N-(1-oxo-3-phenylpropan-2-yl)benzamide |
|---|---|
| PubChem CID | 173276331 |
| Molecular Formula | C28H23NO2 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | 3-(2-naphthalen-2-ylethenyl)-N-(1-oxo-3-phenylpropan-2-yl)benzamide |
| SMILES | O=CC(Cc1ccccc1)NC(=O)c1cccc(C=Cc2ccc3ccccc3c2)c1 |
| InChI | InChI=1S/C28H23NO2/c30-20-27(19-21-7-2-1-3-8-21)29-28(31)26-12-6-9-22(18-26)13-14-23-15-16-24-10-4-5-11-25(24)17-23/h1-18,20,27H,19H2,(H,29,31) |
| InChIKey | RASBDARIVIZDKE-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|