C25H21N3O4S — CID 22988100
2-(naphthalen-2-ylsulfonylamino)-N-(1-oxo-3-phenylpropan-2-yl)pyridine-3-carboxamide (PubChem CID 22988100) has the molecular formula C25H21N3O4S and a molecular weight of 459.53 g/mol. Its IUPAC name is 2-(naphthalen-2-ylsulfonylamino)-N-(1-oxo-3-phenylpropan-2-yl)pyridine-3-carboxamide.
| Compound Name | 2-(naphthalen-2-ylsulfonylamino)-N-(1-oxo-3-phenylpropan-2-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 22988100 |
| Molecular Formula | C25H21N3O4S |
| Molecular Weight | 459.53 g/mol |
| Exact Mass | 459.13 |
| IUPAC Name | 2-(naphthalen-2-ylsulfonylamino)-N-(1-oxo-3-phenylpropan-2-yl)pyridine-3-carboxamide |
| SMILES | O=CC(Cc1ccccc1)NC(=O)c1cccnc1NS(=O)(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C25H21N3O4S/c29-17-21(15-18-7-2-1-3-8-18)27-25(30)23-11-6-14-26-24(23)28-33(31,32)22-13-12-19-9-4-5-10-20(19)16-22/h1-14,16-17,21H,15H2,(H,26,28)(H,27,30) |
| InChIKey | MBBSWROVDKIONG-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 105.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.53 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|