C26H28N2O4S — CID 87594477
N'-naphthalen-2-ylsulfonyl-N-[(2S)-1-oxo-3-phenylpropan-2-yl]cyclohexanecarbohydrazide (PubChem CID 87594477) has the molecular formula C26H28N2O4S and a molecular weight of 464.59 g/mol. Its IUPAC name is N'-naphthalen-2-ylsulfonyl-N-[(2S)-1-oxo-3-phenylpropan-2-yl]cyclohexanecarbohydrazide.
| Compound Name | N'-naphthalen-2-ylsulfonyl-N-[(2S)-1-oxo-3-phenylpropan-2-yl]cyclohexanecarbohydrazide |
|---|---|
| PubChem CID | 87594477 |
| Molecular Formula | C26H28N2O4S |
| Molecular Weight | 464.59 g/mol |
| Exact Mass | 464.18 |
| IUPAC Name | N'-naphthalen-2-ylsulfonyl-N-[(2S)-1-oxo-3-phenylpropan-2-yl]cyclohexanecarbohydrazide |
| SMILES | O=C[C@H](Cc1ccccc1)N(NS(=O)(=O)c1ccc2ccccc2c1)C(=O)C1CCCCC1 |
| InChI | InChI=1S/C26H28N2O4S/c29-19-24(17-20-9-3-1-4-10-20)28(26(30)22-12-5-2-6-13-22)27-33(31,32)25-16-15-21-11-7-8-14-23(21)18-25/h1,3-4,7-11,14-16,18-19,22,24,27H,2,5-6,12-13,17H2/t24-/m0/s1 |
| InChIKey | TXQDWADKNHNNSL-DEOSSOPVSA-N |
| XLogP | 4.25 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.59 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|