C26H33ClN4O3S — CID 11318305
1-[[4-(aminomethyl)phenyl]methyl]-3-cycloheptyl-1-(naphthalen-2-ylsulfonylamino)urea;hydrochloride (PubChem CID 11318305) has the molecular formula C26H33ClN4O3S and a molecular weight of 517.10 g/mol. Its IUPAC name is 1-[[4-(aminomethyl)phenyl]methyl]-3-cycloheptyl-1-(naphthalen-2-ylsulfonylamino)urea;hydrochloride.
| Compound Name | 1-[[4-(aminomethyl)phenyl]methyl]-3-cycloheptyl-1-(naphthalen-2-ylsulfonylamino)urea;hydrochloride |
|---|---|
| PubChem CID | 11318305 |
| Molecular Formula | C26H33ClN4O3S |
| Molecular Weight | 517.10 g/mol |
| Exact Mass | 516.20 |
| IUPAC Name | 1-[[4-(aminomethyl)phenyl]methyl]-3-cycloheptyl-1-(naphthalen-2-ylsulfonylamino)urea;hydrochloride |
| SMILES | Cl.NCc1ccc(CN(NS(=O)(=O)c2ccc3ccccc3c2)C(=O)NC2CCCCCC2)cc1 |
| InChI | InChI=1S/C26H32N4O3S.ClH/c27-18-20-11-13-21(14-12-20)19-30(26(31)28-24-9-3-1-2-4-10-24)29-34(32,33)25-16-15-22-7-5-6-8-23(22)17-25;/h5-8,11-17,24,29H,1-4,9-10,18-19,27H2,(H,28,31);1H |
| InChIKey | FRKZZKQCWGWWEZ-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.10 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|