C24H27N5O4S — CID 10906977
N'-hydroxy-4-[[(naphthalen-2-ylsulfonylamino)-(piperidine-1-carbonyl)amino]methyl]benzenecarboximidamide (PubChem CID 10906977) has the molecular formula C24H27N5O4S and a molecular weight of 481.58 g/mol. Its IUPAC name is N'-hydroxy-4-[[(naphthalen-2-ylsulfonylamino)-(piperidine-1-carbonyl)amino]methyl]benzenecarboximidamide.
| Compound Name | N'-hydroxy-4-[[(naphthalen-2-ylsulfonylamino)-(piperidine-1-carbonyl)amino]methyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 10906977 |
| Molecular Formula | C24H27N5O4S |
| Molecular Weight | 481.58 g/mol |
| Exact Mass | 481.18 |
| IUPAC Name | N'-hydroxy-4-[[(naphthalen-2-ylsulfonylamino)-(piperidine-1-carbonyl)amino]methyl]benzenecarboximidamide |
| SMILES | N/C(=N\O)c1ccc(CN(NS(=O)(=O)c2ccc3ccccc3c2)C(=O)N2CCCCC2)cc1 |
| InChI | InChI=1S/C24H27N5O4S/c25-23(26-31)20-10-8-18(9-11-20)17-29(24(30)28-14-4-1-5-15-28)27-34(32,33)22-13-12-19-6-2-3-7-21(19)16-22/h2-3,6-13,16,27,31H,1,4-5,14-15,17H2,(H2,25,26) |
| InChIKey | SAIGVFQIHXWUBA-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 128.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.58 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|