C15H23N5O2 — CID 142150262
3-[[amino(azepane-1-carbonyl)amino]methyl]-N'-hydroxybenzenecarboximidamide (PubChem CID 142150262) has the molecular formula C15H23N5O2 and a molecular weight of 305.38 g/mol. Its IUPAC name is 3-[[amino(azepane-1-carbonyl)amino]methyl]-N'-hydroxybenzenecarboximidamide.
| Compound Name | 3-[[amino(azepane-1-carbonyl)amino]methyl]-N'-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 142150262 |
| Molecular Formula | C15H23N5O2 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.19 |
| IUPAC Name | 3-[[amino(azepane-1-carbonyl)amino]methyl]-N'-hydroxybenzenecarboximidamide |
| SMILES | N/C(=N\O)c1cccc(CN(N)C(=O)N2CCCCCC2)c1 |
| InChI | InChI=1S/C15H23N5O2/c16-14(18-22)13-7-5-6-12(10-13)11-20(17)15(21)19-8-3-1-2-4-9-19/h5-7,10,22H,1-4,8-9,11,17H2,(H2,16,18) |
| InChIKey | KTJRYUQNMCMZFX-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 108.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'} |
|---|