C25H29N5O4S — CID 90783131
3-[[azepane-1-carbonyl-(naphthalen-2-ylsulfonylamino)amino]methyl]-N'-hydroxybenzenecarboximidamide (PubChem CID 90783131) has the molecular formula C25H29N5O4S and a molecular weight of 495.61 g/mol. Its IUPAC name is 3-[[azepane-1-carbonyl-(naphthalen-2-ylsulfonylamino)amino]methyl]-N'-hydroxybenzenecarboximidamide.
| Compound Name | 3-[[azepane-1-carbonyl-(naphthalen-2-ylsulfonylamino)amino]methyl]-N'-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 90783131 |
| Molecular Formula | C25H29N5O4S |
| Molecular Weight | 495.61 g/mol |
| Exact Mass | 495.19 |
| IUPAC Name | 3-[[azepane-1-carbonyl-(naphthalen-2-ylsulfonylamino)amino]methyl]-N'-hydroxybenzenecarboximidamide |
| SMILES | NC(=NO)c1cccc(CN(NS(=O)(=O)c2ccc3ccccc3c2)C(=O)N2CCCCCC2)c1 |
| InChI | InChI=1S/C25H29N5O4S/c26-24(27-32)22-11-7-8-19(16-22)18-30(25(31)29-14-5-1-2-6-15-29)28-35(33,34)23-13-12-20-9-3-4-10-21(20)17-23/h3-4,7-13,16-17,28,32H,1-2,5-6,14-15,18H2,(H2,26,27) |
| InChIKey | GJDCYHGXHQTSHH-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 128.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.61 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|