C32H34N6O5S — CID 134304931
N-benzyl-4-[3-[3-[(Z)-N'-hydroxycarbamimidoyl]phenyl]-2-(naphthalen-2-ylsulfonylamino)propanoyl]piperazine-1-carboxamide (PubChem CID 134304931) has the molecular formula C32H34N6O5S and a molecular weight of 614.73 g/mol. Its IUPAC name is N-benzyl-4-[3-[3-[(Z)-N'-hydroxycarbamimidoyl]phenyl]-2-(naphthalen-2-ylsulfonylamino)propanoyl]piperazine-1-carboxamide.
| Compound Name | N-benzyl-4-[3-[3-[(Z)-N'-hydroxycarbamimidoyl]phenyl]-2-(naphthalen-2-ylsulfonylamino)propanoyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 134304931 |
| Molecular Formula | C32H34N6O5S |
| Molecular Weight | 614.73 g/mol |
| Exact Mass | 614.23 |
| IUPAC Name | N-benzyl-4-[3-[3-[(Z)-N'-hydroxycarbamimidoyl]phenyl]-2-(naphthalen-2-ylsulfonylamino)propanoyl]piperazine-1-carboxamide |
| SMILES | N/C(=N\O)c1cccc(CC(NS(=O)(=O)c2ccc3ccccc3c2)C(=O)N2CCN(C(=O)NCc3ccccc3)CC2)c1 |
| InChI | InChI=1S/C32H34N6O5S/c33-30(35-41)27-12-6-9-24(19-27)20-29(36-44(42,43)28-14-13-25-10-4-5-11-26(25)21-28)31(39)37-15-17-38(18-16-37)32(40)34-22-23-7-2-1-3-8-23/h1-14,19,21,29,36,41H,15-18,20,22H2,(H2,33,35)(H,34,40) |
| InChIKey | BWMLWRWPYZZNEQ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 157.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.73 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|