C21H28N6O5S — CID 66994465
4-[5-(diaminomethylideneamino)-2-(naphthalen-2-ylsulfonylamino)pentanoyl]piperazine-1-carboxylic acid (PubChem CID 66994465) has the molecular formula C21H28N6O5S and a molecular weight of 476.56 g/mol. Its IUPAC name is 4-[5-(diaminomethylideneamino)-2-(naphthalen-2-ylsulfonylamino)pentanoyl]piperazine-1-carboxylic acid.
| Compound Name | 4-[5-(diaminomethylideneamino)-2-(naphthalen-2-ylsulfonylamino)pentanoyl]piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 66994465 |
| Molecular Formula | C21H28N6O5S |
| Molecular Weight | 476.56 g/mol |
| Exact Mass | 476.18 |
| IUPAC Name | 4-[5-(diaminomethylideneamino)-2-(naphthalen-2-ylsulfonylamino)pentanoyl]piperazine-1-carboxylic acid |
| SMILES | NC(N)=NCCCC(NS(=O)(=O)c1ccc2ccccc2c1)C(=O)N1CCN(C(=O)O)CC1 |
| InChI | InChI=1S/C21H28N6O5S/c22-20(23)24-9-3-6-18(19(28)26-10-12-27(13-11-26)21(29)30)25-33(31,32)17-8-7-15-4-1-2-5-16(15)14-17/h1-2,4-5,7-8,14,18,25H,3,6,9-13H2,(H,29,30)(H4,22,23,24) |
| InChIKey | KJDILFLNJAUYAD-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 171.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.56 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|