C29H41N5O5S — CID 54096088
3-[1-[(2S)-5-(diaminomethylideneamino)-2-[[3-(2-phenylpropan-2-yl)phenyl]sulfonylamino]pentanoyl]piperidin-4-yl]propanoic acid (PubChem CID 54096088) has the molecular formula C29H41N5O5S and a molecular weight of 571.74 g/mol. Its IUPAC name is 3-[1-[(2S)-5-(diaminomethylideneamino)-2-[[3-(2-phenylpropan-2-yl)phenyl]sulfonylamino]pentanoyl]piperidin-4-yl]propanoic acid.
| Compound Name | 3-[1-[(2S)-5-(diaminomethylideneamino)-2-[[3-(2-phenylpropan-2-yl)phenyl]sulfonylamino]pentanoyl]piperidin-4-yl]propanoic acid |
|---|---|
| PubChem CID | 54096088 |
| Molecular Formula | C29H41N5O5S |
| Molecular Weight | 571.74 g/mol |
| Exact Mass | 571.28 |
| IUPAC Name | 3-[1-[(2S)-5-(diaminomethylideneamino)-2-[[3-(2-phenylpropan-2-yl)phenyl]sulfonylamino]pentanoyl]piperidin-4-yl]propanoic acid |
| SMILES | CC(C)(c1ccccc1)c1cccc(S(=O)(=O)N[C@@H](CCCN=C(N)N)C(=O)N2CCC(CCC(=O)O)CC2)c1 |
| InChI | InChI=1S/C29H41N5O5S/c1-29(2,22-8-4-3-5-9-22)23-10-6-11-24(20-23)40(38,39)33-25(12-7-17-32-28(30)31)27(37)34-18-15-21(16-19-34)13-14-26(35)36/h3-6,8-11,20-21,25,33H,7,12-19H2,1-2H3,(H,35,36)(H4,30,31,32)/t25-/m0/s1 |
| InChIKey | MXEWZEMCOQGCPN-VWLOTQADSA-N |
| XLogP | 2.82 |
| TPSA | 168.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.74 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|