C27H38N6O6S — CID 10579040
2-[(4S)-5-[(2R)-2-(hydroxymethyl)piperidin-1-yl]-5-oxo-4-[[3-(2-phenylpropan-2-yl)phenyl]sulfonylamino]pentyl]-1-nitroguanidine (PubChem CID 10579040) has the molecular formula C27H38N6O6S and a molecular weight of 574.70 g/mol. Its IUPAC name is 2-[(4S)-5-[(2R)-2-(hydroxymethyl)piperidin-1-yl]-5-oxo-4-[[3-(2-phenylpropan-2-yl)phenyl]sulfonylamino]pentyl]-1-nitroguanidine.
| Compound Name | 2-[(4S)-5-[(2R)-2-(hydroxymethyl)piperidin-1-yl]-5-oxo-4-[[3-(2-phenylpropan-2-yl)phenyl]sulfonylamino]pentyl]-1-nitroguanidine |
|---|---|
| PubChem CID | 10579040 |
| Molecular Formula | C27H38N6O6S |
| Molecular Weight | 574.70 g/mol |
| Exact Mass | 574.26 |
| IUPAC Name | 2-[(4S)-5-[(2R)-2-(hydroxymethyl)piperidin-1-yl]-5-oxo-4-[[3-(2-phenylpropan-2-yl)phenyl]sulfonylamino]pentyl]-1-nitroguanidine |
| SMILES | CC(C)(c1ccccc1)c1cccc(S(=O)(=O)N[C@@H](CCC/N=C(\N)N[N+](=O)[O-])C(=O)N2CCCC[C@@H]2CO)c1 |
| InChI | InChI=1S/C27H38N6O6S/c1-27(2,20-10-4-3-5-11-20)21-12-8-14-23(18-21)40(38,39)31-24(15-9-16-29-26(28)30-33(36)37)25(35)32-17-7-6-13-22(32)19-34/h3-5,8,10-12,14,18,22,24,31,34H,6-7,9,13,15-17,19H2,1-2H3,(H3,28,29,30)/t22-,24+/m1/s1 |
| InChIKey | QILLAMMAFRLJJA-VWNXMTODSA-N |
| XLogP | 1.91 |
| TPSA | 180.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.70 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|