C30H37N7O7S — CID 169444789
benzyl (2R,4S)-1-[(2S)-5-[[amino(nitramido)methylidene]amino]-2-[(3-methylquinolin-8-yl)sulfonylamino]pentanoyl]-4-methylpiperidine-2-carboxylate (PubChem CID 169444789) has the molecular formula C30H37N7O7S and a molecular weight of 639.74 g/mol. Its IUPAC name is benzyl (2R,4S)-1-[(2S)-5-[[amino(nitramido)methylidene]amino]-2-[(3-methylquinolin-8-yl)sulfonylamino]pentanoyl]-4-methylpiperidine-2-carboxylate.
| Compound Name | benzyl (2R,4S)-1-[(2S)-5-[[amino(nitramido)methylidene]amino]-2-[(3-methylquinolin-8-yl)sulfonylamino]pentanoyl]-4-methylpiperidine-2-carboxylate |
|---|---|
| PubChem CID | 169444789 |
| Molecular Formula | C30H37N7O7S |
| Molecular Weight | 639.74 g/mol |
| Exact Mass | 639.25 |
| IUPAC Name | benzyl (2R,4S)-1-[(2S)-5-[[amino(nitramido)methylidene]amino]-2-[(3-methylquinolin-8-yl)sulfonylamino]pentanoyl]-4-methylpiperidine-2-carboxylate |
| SMILES | Cc1cnc2c(S(=O)(=O)N[C@@H](CCC/N=C(\N)N[N+](=O)[O-])C(=O)N3CC[C@H](C)C[C@@H]3C(=O)OCc3ccccc3)cccc2c1 |
| InChI | InChI=1S/C30H37N7O7S/c1-20-13-15-36(25(17-20)29(39)44-19-22-8-4-3-5-9-22)28(38)24(11-7-14-32-30(31)34-37(40)41)35-45(42,43)26-12-6-10-23-16-21(2)18-33-27(23)26/h3-6,8-10,12,16,18,20,24-25,35H,7,11,13-15,17,19H2,1-2H3,(H3,31,32,34)/t20-,24-,25+/m0/s1 |
| InChIKey | AXELVPUEIVSRLB-KSNOWIBYSA-N |
| XLogP | 2.44 |
| TPSA | 199.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.74 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|