C20H36N6O7 — CID 59905358
ethyl 1-[(2R)-5-[[amino(nitramido)methylidene]amino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]-4-methylpiperidine-2-carboxylate (PubChem CID 59905358) has the molecular formula C20H36N6O7 and a molecular weight of 472.54 g/mol. Its IUPAC name is ethyl 1-[(2R)-5-[[amino(nitramido)methylidene]amino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]-4-methylpiperidine-2-carboxylate.
| Compound Name | ethyl 1-[(2R)-5-[[amino(nitramido)methylidene]amino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]-4-methylpiperidine-2-carboxylate |
|---|---|
| PubChem CID | 59905358 |
| Molecular Formula | C20H36N6O7 |
| Molecular Weight | 472.54 g/mol |
| Exact Mass | 472.26 |
| IUPAC Name | ethyl 1-[(2R)-5-[[amino(nitramido)methylidene]amino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]-4-methylpiperidine-2-carboxylate |
| SMILES | CCOC(=O)C1CC(C)CCN1C(=O)[C@@H](CCC/N=C(\N)N[N+](=O)[O-])NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H36N6O7/c1-6-32-17(28)15-12-13(2)9-11-25(15)16(27)14(23-19(29)33-20(3,4)5)8-7-10-22-18(21)24-26(30)31/h13-15H,6-12H2,1-5H3,(H,23,29)(H3,21,22,24)/t13?,14-,15?/m1/s1 |
| InChIKey | IXUJSLMIDVNADJ-SHARSMKWSA-N |
| XLogP | 0.95 |
| TPSA | 178.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.54 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|