C15H29ClN6O5 — CID 169410046
ethyl (2R,4R)-1-[2-amino-5-[(N'-nitrocarbamimidoyl)amino]pentanoyl]-4-methylpiperidine-2-carboxylate;hydrochloride (PubChem CID 169410046) has the molecular formula C15H29ClN6O5 and a molecular weight of 408.89 g/mol. Its IUPAC name is ethyl (2R,4R)-1-[2-amino-5-[(N'-nitrocarbamimidoyl)amino]pentanoyl]-4-methylpiperidine-2-carboxylate;hydrochloride.
| Compound Name | ethyl (2R,4R)-1-[2-amino-5-[(N'-nitrocarbamimidoyl)amino]pentanoyl]-4-methylpiperidine-2-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 169410046 |
| Molecular Formula | C15H29ClN6O5 |
| Molecular Weight | 408.89 g/mol |
| Exact Mass | 408.19 |
| IUPAC Name | ethyl (2R,4R)-1-[2-amino-5-[(N'-nitrocarbamimidoyl)amino]pentanoyl]-4-methylpiperidine-2-carboxylate;hydrochloride |
| SMILES | CCOC(=O)[C@H]1C[C@H](C)CCN1C(=O)C(N)CCCNC(N)=N[N+](=O)[O-].Cl |
| InChI | InChI=1S/C15H28N6O5.ClH/c1-3-26-14(23)12-9-10(2)6-8-20(12)13(22)11(16)5-4-7-18-15(17)19-21(24)25;/h10-12H,3-9,16H2,1-2H3,(H3,17,18,19);1H/t10-,11?,12-;/m1./s1 |
| InChIKey | KYMBEZAOVMYAGM-ZZCQIGCDSA-N |
| XLogP | -0.20 |
| TPSA | 166.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.89 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|