About 1-butyl-2-nitroguanidine
1-butyl-2-nitroguanidine (PubChem CID 135996675) has the molecular formula C5H12N4O2
and a molecular weight of 160.18 g/mol. Its IUPAC name is 1-butyl-2-nitroguanidine.
Molecular Properties
| Compound Name | 1-butyl-2-nitroguanidine |
| PubChem CID | 135996675 |
| Molecular Formula | C5H12N4O2 |
| Molecular Weight | 160.18 g/mol |
| Exact Mass | 160.10 |
| IUPAC Name | 1-butyl-2-nitroguanidine |
| SMILES | CCCCN/C(N)=N/[N+](=O)[O-] |
| InChI | InChI=1S/C5H12N4O2/c1-2-3-4-7-5(6)8-9(10)11/h2-4H2,1H3,(H3,6,7,8) |
| InChIKey | KPQHRDFCWBWTBA-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 93.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.18 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|
Analyze 1-butyl-2-nitroguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-2-nitroguanidine?
The IUPAC name of 1-butyl-2-nitroguanidine (CID 135996675) is 1-butyl-2-nitroguanidine.
What is the SMILES notation for 1-butyl-2-nitroguanidine?
The canonical SMILES for 1-butyl-2-nitroguanidine is CCCCN/C(N)=N/[N+](=O)[O-].
What is the InChIKey of 1-butyl-2-nitroguanidine?
The InChIKey is KPQHRDFCWBWTBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12N4O2/c1-2-3-4-7-5(6)8-9(10)11/h2-4H2,1H3,(H3,6,7,8).
What are the key properties of 1-butyl-2-nitroguanidine?
1-butyl-2-nitroguanidine has a molecular weight of 160.18 g/mol, XLogP of -0.12, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-2-nitroguanidine is sourced from PubChem (CID 135996675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).