C9H24N3O4P — CID 166600390
1,2-dibutylguanidine;phosphoric acid (PubChem CID 166600390) has the molecular formula C9H24N3O4P and a molecular weight of 269.28 g/mol. Its IUPAC name is 1,2-dibutylguanidine;phosphoric acid.
| Compound Name | 1,2-dibutylguanidine;phosphoric acid |
|---|---|
| PubChem CID | 166600390 |
| Molecular Formula | C9H24N3O4P |
| Molecular Weight | 269.28 g/mol |
| Exact Mass | 269.15 |
| IUPAC Name | 1,2-dibutylguanidine;phosphoric acid |
| SMILES | CCCC/N=C(\N)NCCCC.O=P(O)(O)O |
| InChI | InChI=1S/C9H21N3.H3O4P/c1-3-5-7-11-9(10)12-8-6-4-2;1-5(2,3)4/h3-8H2,1-2H3,(H3,10,11,12);(H3,1,2,3,4) |
| InChIKey | RPMQNVVUCKLKNX-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 128.17 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.28 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|