1,2-dibutylguanidine;phosphoric acid

C9H24N3O4P — CID 166600390

IUPAC1,2-dibutylguanidine;phosphoric acid
SMILESCCCC/N=C(\N)NCCCC.O=P(O)(O)O
InChIInChI=1S/C9H21N3.H3O4P/c1-3-5-7-11-9(10)12-8-6-4-2;1-5(2,3)4/h3-8H2,1-2H3,(H3,10,11,12);(H3,1,2,3,4)
InChIKeyRPMQNVVUCKLKNX-UHFFFAOYSA-N
MW269.28 g/mol
LogP0.56
Rot. Bonds6

About 1,2-dibutylguanidine;phosphoric acid

1,2-dibutylguanidine;phosphoric acid (PubChem CID 166600390) has the molecular formula C9H24N3O4P and a molecular weight of 269.28 g/mol. Its IUPAC name is 1,2-dibutylguanidine;phosphoric acid.

Molecular Properties

Compound Name1,2-dibutylguanidine;phosphoric acid
PubChem CID166600390
Molecular FormulaC9H24N3O4P
Molecular Weight269.28 g/mol
Exact Mass269.15
IUPAC Name1,2-dibutylguanidine;phosphoric acid
SMILESCCCC/N=C(\N)NCCCC.O=P(O)(O)O
InChIInChI=1S/C9H21N3.H3O4P/c1-3-5-7-11-9(10)12-8-6-4-2;1-5(2,3)4/h3-8H2,1-2H3,(H3,10,11,12);(H3,1,2,3,4)
InChIKeyRPMQNVVUCKLKNX-UHFFFAOYSA-N
XLogP0.56
TPSA128.17 Ų
H-Bond Donors5
H-Bond Acceptors2
Rotatable Bonds6
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500269.28
LogP ≤ 50.56
H-Bond Donors ≤ 55
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze 1,2-dibutylguanidine;phosphoric acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1,2-dibutylguanidine;phosphoric acid?
The IUPAC name of 1,2-dibutylguanidine;phosphoric acid (CID 166600390) is 1,2-dibutylguanidine;phosphoric acid.
What is the SMILES notation for 1,2-dibutylguanidine;phosphoric acid?
The canonical SMILES for 1,2-dibutylguanidine;phosphoric acid is CCCC/N=C(\N)NCCCC.O=P(O)(O)O.
What is the InChIKey of 1,2-dibutylguanidine;phosphoric acid?
The InChIKey is RPMQNVVUCKLKNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H21N3.H3O4P/c1-3-5-7-11-9(10)12-8-6-4-2;1-5(2,3)4/h3-8H2,1-2H3,(H3,10,11,12);(H3,1,2,3,4).
What are the key properties of 1,2-dibutylguanidine;phosphoric acid?
1,2-dibutylguanidine;phosphoric acid has a molecular weight of 269.28 g/mol, XLogP of 0.56, 6 rotatable bonds, 5 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dibutylguanidine;phosphoric acid is sourced from PubChem (CID 166600390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).