C11H24N4O — CID 111077863
3-[(N'-butylcarbamimidoyl)amino]-N-propylpropanamide (PubChem CID 111077863) has the molecular formula C11H24N4O and a molecular weight of 228.34 g/mol. Its IUPAC name is 3-[(N'-butylcarbamimidoyl)amino]-N-propylpropanamide.
| Compound Name | 3-[(N'-butylcarbamimidoyl)amino]-N-propylpropanamide |
|---|---|
| PubChem CID | 111077863 |
| Molecular Formula | C11H24N4O |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.20 |
| IUPAC Name | 3-[(N'-butylcarbamimidoyl)amino]-N-propylpropanamide |
| SMILES | CCCC/N=C(\N)NCCC(=O)NCCC |
| InChI | InChI=1S/C11H24N4O/c1-3-5-8-14-11(12)15-9-6-10(16)13-7-4-2/h3-9H2,1-2H3,(H,13,16)(H3,12,14,15) |
| InChIKey | NBLMXYZYWHAJQZ-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|