C16H25BrN4O — CID 111076869
N-(4-bromophenyl)-3-[(N'-hexylcarbamimidoyl)amino]propanamide (PubChem CID 111076869) has the molecular formula C16H25BrN4O and a molecular weight of 369.31 g/mol. Its IUPAC name is N-(4-bromophenyl)-3-[(N'-hexylcarbamimidoyl)amino]propanamide.
| Compound Name | N-(4-bromophenyl)-3-[(N'-hexylcarbamimidoyl)amino]propanamide |
|---|---|
| PubChem CID | 111076869 |
| Molecular Formula | C16H25BrN4O |
| Molecular Weight | 369.31 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | N-(4-bromophenyl)-3-[(N'-hexylcarbamimidoyl)amino]propanamide |
| SMILES | CCCCCC/N=C(\N)NCCC(=O)Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C16H25BrN4O/c1-2-3-4-5-11-19-16(18)20-12-10-15(22)21-14-8-6-13(17)7-9-14/h6-9H,2-5,10-12H2,1H3,(H,21,22)(H3,18,19,20) |
| InChIKey | ADIQPUVBQIEGDM-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.31 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|