C18H22BrIN4O — CID 111076856
3-[[amino-(2-phenylethylamino)methylidene]amino]-N-(4-bromophenyl)propanamide;hydroiodide (PubChem CID 111076856) has the molecular formula C18H22BrIN4O and a molecular weight of 517.21 g/mol. Its IUPAC name is 3-[[amino-(2-phenylethylamino)methylidene]amino]-N-(4-bromophenyl)propanamide;hydroiodide.
| Compound Name | 3-[[amino-(2-phenylethylamino)methylidene]amino]-N-(4-bromophenyl)propanamide;hydroiodide |
|---|---|
| PubChem CID | 111076856 |
| Molecular Formula | C18H22BrIN4O |
| Molecular Weight | 517.21 g/mol |
| Exact Mass | 516.00 |
| IUPAC Name | 3-[[amino-(2-phenylethylamino)methylidene]amino]-N-(4-bromophenyl)propanamide;hydroiodide |
| SMILES | I.N/C(=N\CCC(=O)Nc1ccc(Br)cc1)NCCc1ccccc1 |
| InChI | InChI=1S/C18H21BrN4O.HI/c19-15-6-8-16(9-7-15)23-17(24)11-13-22-18(20)21-12-10-14-4-2-1-3-5-14;/h1-9H,10-13H2,(H,23,24)(H3,20,21,22);1H |
| InChIKey | LSAKYTZDQLIWJU-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.21 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|