C17H20BrIN4O2 — CID 111076842
3-[[amino-(2-methoxyanilino)methylidene]amino]-N-(4-bromophenyl)propanamide;hydroiodide (PubChem CID 111076842) has the molecular formula C17H20BrIN4O2 and a molecular weight of 519.18 g/mol. Its IUPAC name is 3-[[amino-(2-methoxyanilino)methylidene]amino]-N-(4-bromophenyl)propanamide;hydroiodide.
| Compound Name | 3-[[amino-(2-methoxyanilino)methylidene]amino]-N-(4-bromophenyl)propanamide;hydroiodide |
|---|---|
| PubChem CID | 111076842 |
| Molecular Formula | C17H20BrIN4O2 |
| Molecular Weight | 519.18 g/mol |
| Exact Mass | 517.98 |
| IUPAC Name | 3-[[amino-(2-methoxyanilino)methylidene]amino]-N-(4-bromophenyl)propanamide;hydroiodide |
| SMILES | COc1ccccc1N/C(N)=N/CCC(=O)Nc1ccc(Br)cc1.I |
| InChI | InChI=1S/C17H19BrN4O2.HI/c1-24-15-5-3-2-4-14(15)22-17(19)20-11-10-16(23)21-13-8-6-12(18)7-9-13;/h2-9H,10-11H2,1H3,(H,21,23)(H3,19,20,22);1H |
| InChIKey | JZSDZBIIROLTOE-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 88.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.18 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|