C18H22BrIN4O3 — CID 111076892
3-[[amino-(2,5-dimethoxyanilino)methylidene]amino]-N-(4-bromophenyl)propanamide;hydroiodide (PubChem CID 111076892) has the molecular formula C18H22BrIN4O3 and a molecular weight of 549.21 g/mol. Its IUPAC name is 3-[[amino-(2,5-dimethoxyanilino)methylidene]amino]-N-(4-bromophenyl)propanamide;hydroiodide.
| Compound Name | 3-[[amino-(2,5-dimethoxyanilino)methylidene]amino]-N-(4-bromophenyl)propanamide;hydroiodide |
|---|---|
| PubChem CID | 111076892 |
| Molecular Formula | C18H22BrIN4O3 |
| Molecular Weight | 549.21 g/mol |
| Exact Mass | 547.99 |
| IUPAC Name | 3-[[amino-(2,5-dimethoxyanilino)methylidene]amino]-N-(4-bromophenyl)propanamide;hydroiodide |
| SMILES | COc1ccc(OC)c(N/C(N)=N/CCC(=O)Nc2ccc(Br)cc2)c1.I |
| InChI | InChI=1S/C18H21BrN4O3.HI/c1-25-14-7-8-16(26-2)15(11-14)23-18(20)21-10-9-17(24)22-13-5-3-12(19)4-6-13;/h3-8,11H,9-10H2,1-2H3,(H,22,24)(H3,20,21,23);1H |
| InChIKey | JGZBWORFZGDHQQ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.21 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|