C19H24ClIN4O3 — CID 111092447
3-[[amino-(2,5-dimethoxyanilino)methylidene]amino]-N-(3-chloro-2-methylphenyl)propanamide;hydroiodide (PubChem CID 111092447) has the molecular formula C19H24ClIN4O3 and a molecular weight of 518.78 g/mol. Its IUPAC name is 3-[[amino-(2,5-dimethoxyanilino)methylidene]amino]-N-(3-chloro-2-methylphenyl)propanamide;hydroiodide.
| Compound Name | 3-[[amino-(2,5-dimethoxyanilino)methylidene]amino]-N-(3-chloro-2-methylphenyl)propanamide;hydroiodide |
|---|---|
| PubChem CID | 111092447 |
| Molecular Formula | C19H24ClIN4O3 |
| Molecular Weight | 518.78 g/mol |
| Exact Mass | 518.06 |
| IUPAC Name | 3-[[amino-(2,5-dimethoxyanilino)methylidene]amino]-N-(3-chloro-2-methylphenyl)propanamide;hydroiodide |
| SMILES | COc1ccc(OC)c(N/C(N)=N/CCC(=O)Nc2cccc(Cl)c2C)c1.I |
| InChI | InChI=1S/C19H23ClN4O3.HI/c1-12-14(20)5-4-6-15(12)23-18(25)9-10-22-19(21)24-16-11-13(26-2)7-8-17(16)27-3;/h4-8,11H,9-10H2,1-3H3,(H,23,25)(H3,21,22,24);1H |
| InChIKey | HKJIESUFRYSAJD-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.78 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|