C16H16BrN3O2 — CID 24818621
1-(4-bromophenyl)-3-(3-phenylpropanoylamino)urea (PubChem CID 24818621) has the molecular formula C16H16BrN3O2 and a molecular weight of 362.23 g/mol. Its IUPAC name is 1-(4-bromophenyl)-3-(3-phenylpropanoylamino)urea.
| Compound Name | 1-(4-bromophenyl)-3-(3-phenylpropanoylamino)urea |
|---|---|
| PubChem CID | 24818621 |
| Molecular Formula | C16H16BrN3O2 |
| Molecular Weight | 362.23 g/mol |
| Exact Mass | 361.04 |
| IUPAC Name | 1-(4-bromophenyl)-3-(3-phenylpropanoylamino)urea |
| SMILES | O=C(CCc1ccccc1)NNC(=O)Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C16H16BrN3O2/c17-13-7-9-14(10-8-13)18-16(22)20-19-15(21)11-6-12-4-2-1-3-5-12/h1-5,7-10H,6,11H2,(H,19,21)(H2,18,20,22) |
| InChIKey | CPQKJTFMMLUTMG-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.23 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|