C16H16BrN3O4 — CID 17388380
1-(4-bromophenyl)-3-[3-(3,4-dihydroxyphenyl)propanoylamino]urea (PubChem CID 17388380) has the molecular formula C16H16BrN3O4 and a molecular weight of 394.23 g/mol. Its IUPAC name is 1-(4-bromophenyl)-3-[3-(3,4-dihydroxyphenyl)propanoylamino]urea.
| Compound Name | 1-(4-bromophenyl)-3-[3-(3,4-dihydroxyphenyl)propanoylamino]urea |
|---|---|
| PubChem CID | 17388380 |
| Molecular Formula | C16H16BrN3O4 |
| Molecular Weight | 394.23 g/mol |
| Exact Mass | 393.03 |
| IUPAC Name | 1-(4-bromophenyl)-3-[3-(3,4-dihydroxyphenyl)propanoylamino]urea |
| SMILES | O=C(CCc1ccc(O)c(O)c1)NNC(=O)Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C16H16BrN3O4/c17-11-3-5-12(6-4-11)18-16(24)20-19-15(23)8-2-10-1-7-13(21)14(22)9-10/h1,3-7,9,21-22H,2,8H2,(H,19,23)(H2,18,20,24) |
| InChIKey | ITVBUNUFIBWAJJ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 110.69 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.23 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|