C16H16N2O5 — CID 142837694
N'-(3,4-dihydroxyphenyl)-N-(4-hydroxyphenyl)butanediamide (PubChem CID 142837694) has the molecular formula C16H16N2O5 and a molecular weight of 316.31 g/mol. Its IUPAC name is N'-(3,4-dihydroxyphenyl)-N-(4-hydroxyphenyl)butanediamide.
| Compound Name | N'-(3,4-dihydroxyphenyl)-N-(4-hydroxyphenyl)butanediamide |
|---|---|
| PubChem CID | 142837694 |
| Molecular Formula | C16H16N2O5 |
| Molecular Weight | 316.31 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | N'-(3,4-dihydroxyphenyl)-N-(4-hydroxyphenyl)butanediamide |
| SMILES | O=C(CCC(=O)Nc1ccc(O)c(O)c1)Nc1ccc(O)cc1 |
| InChI | InChI=1S/C16H16N2O5/c19-12-4-1-10(2-5-12)17-15(22)7-8-16(23)18-11-3-6-13(20)14(21)9-11/h1-6,9,19-21H,7-8H2,(H,17,22)(H,18,23) |
| InChIKey | TZJVVYYSHWOYOK-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 118.89 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.31 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|