C17H18N2O5 — CID 89193911
4-(3,4-dihydroxyanilino)-N-(3,4-dihydroxyphenyl)pent-4-enamide (PubChem CID 89193911) has the molecular formula C17H18N2O5 and a molecular weight of 330.34 g/mol. Its IUPAC name is 4-(3,4-dihydroxyanilino)-N-(3,4-dihydroxyphenyl)pent-4-enamide.
| Compound Name | 4-(3,4-dihydroxyanilino)-N-(3,4-dihydroxyphenyl)pent-4-enamide |
|---|---|
| PubChem CID | 89193911 |
| Molecular Formula | C17H18N2O5 |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | 4-(3,4-dihydroxyanilino)-N-(3,4-dihydroxyphenyl)pent-4-enamide |
| SMILES | C=C(CCC(=O)Nc1ccc(O)c(O)c1)Nc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C17H18N2O5/c1-10(18-11-3-5-13(20)15(22)8-11)2-7-17(24)19-12-4-6-14(21)16(23)9-12/h3-6,8-9,18,20-23H,1-2,7H2,(H,19,24) |
| InChIKey | FFAOGOIWZKVHOA-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 122.05 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|