C50H63N5O20 — CID 158309178
N,N'-bis[3,4-bis(methoxymethoxy)phenyl]butanediamide;N,N'-bis(3,4-dihydroxyphenyl)butanediamide;3,4-bis(methoxymethoxy)aniline (PubChem CID 158309178) has the molecular formula C50H63N5O20 and a molecular weight of 1054.07 g/mol. Its IUPAC name is N,N'-bis[3,4-bis(methoxymethoxy)phenyl]butanediamide;N,N'-bis(3,4-dihydroxyphenyl)butanediamide;3,4-bis(methoxymethoxy)aniline.
| Compound Name | N,N'-bis[3,4-bis(methoxymethoxy)phenyl]butanediamide;N,N'-bis(3,4-dihydroxyphenyl)butanediamide;3,4-bis(methoxymethoxy)aniline |
|---|---|
| PubChem CID | 158309178 |
| Molecular Formula | C50H63N5O20 |
| Molecular Weight | 1054.07 g/mol |
| Exact Mass | 1053.41 |
| IUPAC Name | N,N'-bis[3,4-bis(methoxymethoxy)phenyl]butanediamide;N,N'-bis(3,4-dihydroxyphenyl)butanediamide;3,4-bis(methoxymethoxy)aniline |
| SMILES | COCOc1ccc(N)cc1OCOC.COCOc1ccc(NC(=O)CCC(=O)Nc2ccc(OCOC)c(OCOC)c2)cc1OCOC.O=C(CCC(=O)Nc1ccc(O)c(O)c1)Nc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C24H32N2O10.C16H16N2O6.C10H15NO4/c1-29-13-33-19-7-5-17(11-21(19)35-15-31-3)25-23(27)9-10-24(28)26-18-6-8-20(34-14-30-2)22(12-18)36-16-32-4;19-11-3-1-9(7-13(11)21)17-15(23)5-6-16(24)18-10-2-4-12(20)14(22)8-10;1-12-6-14-9-4-3-8(11)5-10(9)15-7-13-2/h5-8,11-12H,9-10,13-16H2,1-4H3,(H,25,27)(H,26,28);1-4,7-8,19-22H,5-6H2,(H,17,23)(H,18,24);3-5H,6-7,11H2,1-2H3 |
| InChIKey | GNLSAMRLABAJMR-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 334.10 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 21 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 75 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1054.07 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 21 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|