C9H10O3S — CID 145421410
3-(3,4-dihydroxyphenyl)propanethioic S-acid (PubChem CID 145421410) has the molecular formula C9H10O3S and a molecular weight of 198.24 g/mol. Its IUPAC name is 3-(3,4-dihydroxyphenyl)propanethioic S-acid.
| Compound Name | 3-(3,4-dihydroxyphenyl)propanethioic S-acid |
|---|---|
| PubChem CID | 145421410 |
| Molecular Formula | C9H10O3S |
| Molecular Weight | 198.24 g/mol |
| Exact Mass | 198.04 |
| IUPAC Name | 3-(3,4-dihydroxyphenyl)propanethioic S-acid |
| SMILES | O=C(S)CCc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C9H10O3S/c10-7-3-1-6(5-8(7)11)2-4-9(12)13/h1,3,5,10-11H,2,4H2,(H,12,13) |
| InChIKey | QKSRTRKVYCJXNC-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.24 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|