C11H12O4 — CID 68621917
4-(3,4-dihydroxyphenyl)-2-methylidenebutanoic acid (PubChem CID 68621917) has the molecular formula C11H12O4 and a molecular weight of 208.21 g/mol. Its IUPAC name is 4-(3,4-dihydroxyphenyl)-2-methylidenebutanoic acid.
| Compound Name | 4-(3,4-dihydroxyphenyl)-2-methylidenebutanoic acid |
|---|---|
| PubChem CID | 68621917 |
| Molecular Formula | C11H12O4 |
| Molecular Weight | 208.21 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | 4-(3,4-dihydroxyphenyl)-2-methylidenebutanoic acid |
| SMILES | C=C(CCc1ccc(O)c(O)c1)C(=O)O |
| InChI | InChI=1S/C11H12O4/c1-7(11(14)15)2-3-8-4-5-9(12)10(13)6-8/h4-6,12-13H,1-3H2,(H,14,15) |
| InChIKey | ZGNSHVIGBLLWHZ-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.21 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|