C17H16O4S — CID 122422881
4-[3-(benzenesulfonyl)phenyl]-2-methylidenebutanoic acid (PubChem CID 122422881) has the molecular formula C17H16O4S and a molecular weight of 316.38 g/mol. Its IUPAC name is 4-[3-(benzenesulfonyl)phenyl]-2-methylidenebutanoic acid.
| Compound Name | 4-[3-(benzenesulfonyl)phenyl]-2-methylidenebutanoic acid |
|---|---|
| PubChem CID | 122422881 |
| Molecular Formula | C17H16O4S |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.08 |
| IUPAC Name | 4-[3-(benzenesulfonyl)phenyl]-2-methylidenebutanoic acid |
| SMILES | C=C(CCc1cccc(S(=O)(=O)c2ccccc2)c1)C(=O)O |
| InChI | InChI=1S/C17H16O4S/c1-13(17(18)19)10-11-14-6-5-9-16(12-14)22(20,21)15-7-3-2-4-8-15/h2-9,12H,1,10-11H2,(H,18,19) |
| InChIKey | RXKVOIXVHPOYEG-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|