C9H22N4O3 — CID 161280098
1,2-dibutylguanidine;nitric acid (PubChem CID 161280098) has the molecular formula C9H22N4O3 and a molecular weight of 234.30 g/mol. Its IUPAC name is 1,2-dibutylguanidine;nitric acid.
| Compound Name | 1,2-dibutylguanidine;nitric acid |
|---|---|
| PubChem CID | 161280098 |
| Molecular Formula | C9H22N4O3 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.17 |
| IUPAC Name | 1,2-dibutylguanidine;nitric acid |
| SMILES | CCCC/N=C(\N)NCCCC.O=[N+]([O-])O |
| InChI | InChI=1S/C9H21N3.HNO3/c1-3-5-7-11-9(10)12-8-6-4-2;2-1(3)4/h3-8H2,1-2H3,(H3,10,11,12);(H,2,3,4) |
| InChIKey | VEYUMLCDSNGVTR-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 113.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|