C12H25N5O2 — CID 143157402
6-(diaminomethylideneamino)-N-[2-oxo-2-(propylamino)ethyl]hexanamide (PubChem CID 143157402) has the molecular formula C12H25N5O2 and a molecular weight of 271.36 g/mol. Its IUPAC name is 6-(diaminomethylideneamino)-N-[2-oxo-2-(propylamino)ethyl]hexanamide.
| Compound Name | 6-(diaminomethylideneamino)-N-[2-oxo-2-(propylamino)ethyl]hexanamide |
|---|---|
| PubChem CID | 143157402 |
| Molecular Formula | C12H25N5O2 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.20 |
| IUPAC Name | 6-(diaminomethylideneamino)-N-[2-oxo-2-(propylamino)ethyl]hexanamide |
| SMILES | CCCNC(=O)CNC(=O)CCCCCN=C(N)N |
| InChI | InChI=1S/C12H25N5O2/c1-2-7-15-11(19)9-17-10(18)6-4-3-5-8-16-12(13)14/h2-9H2,1H3,(H,15,19)(H,17,18)(H4,13,14,16) |
| InChIKey | TVAMMGLCJZLHFZ-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 122.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|