C10H23N5O2 — CID 144951076
N-[2-(2-aminoethoxy)ethyl]-5-(diaminomethylideneamino)pentanamide (PubChem CID 144951076) has the molecular formula C10H23N5O2 and a molecular weight of 245.33 g/mol. Its IUPAC name is N-[2-(2-aminoethoxy)ethyl]-5-(diaminomethylideneamino)pentanamide.
| Compound Name | N-[2-(2-aminoethoxy)ethyl]-5-(diaminomethylideneamino)pentanamide |
|---|---|
| PubChem CID | 144951076 |
| Molecular Formula | C10H23N5O2 |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.19 |
| IUPAC Name | N-[2-(2-aminoethoxy)ethyl]-5-(diaminomethylideneamino)pentanamide |
| SMILES | NCCOCCNC(=O)CCCCN=C(N)N |
| InChI | InChI=1S/C10H23N5O2/c11-4-7-17-8-6-14-9(16)3-1-2-5-15-10(12)13/h1-8,11H2,(H,14,16)(H4,12,13,15) |
| InChIKey | UHHBXJZZOKYZNT-UHFFFAOYSA-N |
| XLogP | -1.48 |
| TPSA | 128.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | -1.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|