C4H9N5O4 — CID 155227498
2-[[(E)-N'-nitrocarbamimidoyl]amino]ethylcarbamic acid (PubChem CID 155227498) has the molecular formula C4H9N5O4 and a molecular weight of 191.15 g/mol. Its IUPAC name is 2-[[(E)-N'-nitrocarbamimidoyl]amino]ethylcarbamic acid.
| Compound Name | 2-[[(E)-N'-nitrocarbamimidoyl]amino]ethylcarbamic acid |
|---|---|
| PubChem CID | 155227498 |
| Molecular Formula | C4H9N5O4 |
| Molecular Weight | 191.15 g/mol |
| Exact Mass | 191.07 |
| IUPAC Name | 2-[[(E)-N'-nitrocarbamimidoyl]amino]ethylcarbamic acid |
| SMILES | N/C(=N\[N+](=O)[O-])NCCNC(=O)O |
| InChI | InChI=1S/C4H9N5O4/c5-3(8-9(12)13)6-1-2-7-4(10)11/h7H,1-2H2,(H,10,11)(H3,5,6,8) |
| InChIKey | IOLAXAOCEKABMF-UHFFFAOYSA-N |
| XLogP | -1.65 |
| TPSA | 142.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.15 |
| LogP ≤ 5 | -1.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|