2-[[(E)-N'-nitrocarbamimidoyl]amino]ethylcarbamic acid

C4H9N5O4 — CID 155227498

IUPAC2-[[(E)-N'-nitrocarbamimidoyl]amino]ethylcarbamic acid
SMILESN/C(=N\[N+](=O)[O-])NCCNC(=O)O
InChIInChI=1S/C4H9N5O4/c5-3(8-9(12)13)6-1-2-7-4(10)11/h7H,1-2H2,(H,10,11)(H3,5,6,8)
InChIKeyIOLAXAOCEKABMF-UHFFFAOYSA-N
MW191.15 g/mol
LogP-1.65
Rot. Bonds4

About 2-[[(E)-N'-nitrocarbamimidoyl]amino]ethylcarbamic acid

2-[[(E)-N'-nitrocarbamimidoyl]amino]ethylcarbamic acid (PubChem CID 155227498) has the molecular formula C4H9N5O4 and a molecular weight of 191.15 g/mol. Its IUPAC name is 2-[[(E)-N'-nitrocarbamimidoyl]amino]ethylcarbamic acid.

Molecular Properties

Compound Name2-[[(E)-N'-nitrocarbamimidoyl]amino]ethylcarbamic acid
PubChem CID155227498
Molecular FormulaC4H9N5O4
Molecular Weight191.15 g/mol
Exact Mass191.07
IUPAC Name2-[[(E)-N'-nitrocarbamimidoyl]amino]ethylcarbamic acid
SMILESN/C(=N\[N+](=O)[O-])NCCNC(=O)O
InChIInChI=1S/C4H9N5O4/c5-3(8-9(12)13)6-1-2-7-4(10)11/h7H,1-2H2,(H,10,11)(H3,5,6,8)
InChIKeyIOLAXAOCEKABMF-UHFFFAOYSA-N
XLogP-1.65
TPSA142.88 Ų
H-Bond Donors4
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500191.15
LogP ≤ 5-1.65
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}

Analyze 2-[[(E)-N'-nitrocarbamimidoyl]amino]ethylcarbamic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[[(E)-N'-nitrocarbamimidoyl]amino]ethylcarbamic acid?
The IUPAC name of 2-[[(E)-N'-nitrocarbamimidoyl]amino]ethylcarbamic acid (CID 155227498) is 2-[[(E)-N'-nitrocarbamimidoyl]amino]ethylcarbamic acid.
What is the SMILES notation for 2-[[(E)-N'-nitrocarbamimidoyl]amino]ethylcarbamic acid?
The canonical SMILES for 2-[[(E)-N'-nitrocarbamimidoyl]amino]ethylcarbamic acid is N/C(=N\[N+](=O)[O-])NCCNC(=O)O.
What is the InChIKey of 2-[[(E)-N'-nitrocarbamimidoyl]amino]ethylcarbamic acid?
The InChIKey is IOLAXAOCEKABMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9N5O4/c5-3(8-9(12)13)6-1-2-7-4(10)11/h7H,1-2H2,(H,10,11)(H3,5,6,8).
What are the key properties of 2-[[(E)-N'-nitrocarbamimidoyl]amino]ethylcarbamic acid?
2-[[(E)-N'-nitrocarbamimidoyl]amino]ethylcarbamic acid has a molecular weight of 191.15 g/mol, XLogP of -1.65, 4 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(E)-N'-nitrocarbamimidoyl]amino]ethylcarbamic acid is sourced from PubChem (CID 155227498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).