C12H21N5O3S — CID 173433557
1-[2-[[5-[(dimethylamino)methyl]-4-methylfuran-2-yl]methylsulfanyl]ethyl]-2-nitroguanidine (PubChem CID 173433557) has the molecular formula C12H21N5O3S and a molecular weight of 315.40 g/mol. Its IUPAC name is 1-[2-[[5-[(dimethylamino)methyl]-4-methylfuran-2-yl]methylsulfanyl]ethyl]-2-nitroguanidine.
| Compound Name | 1-[2-[[5-[(dimethylamino)methyl]-4-methylfuran-2-yl]methylsulfanyl]ethyl]-2-nitroguanidine |
|---|---|
| PubChem CID | 173433557 |
| Molecular Formula | C12H21N5O3S |
| Molecular Weight | 315.40 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | 1-[2-[[5-[(dimethylamino)methyl]-4-methylfuran-2-yl]methylsulfanyl]ethyl]-2-nitroguanidine |
| SMILES | Cc1cc(CSCCNC(N)=N[N+](=O)[O-])oc1CN(C)C |
| InChI | InChI=1S/C12H21N5O3S/c1-9-6-10(20-11(9)7-16(2)3)8-21-5-4-14-12(13)15-17(18)19/h6H,4-5,7-8H2,1-3H3,(H3,13,14,15) |
| InChIKey | AKHGASHZHKKHTR-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 109.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.40 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|