C23H32N4O5S2 — CID 70430247
1-N-[2-(2,3-dihydro-1,4-benzodioxin-6-ylmethylsulfanyl)ethyl]-1-N'-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethyl]-2-nitroethene-1,1-diamine (PubChem CID 70430247) has the molecular formula C23H32N4O5S2 and a molecular weight of 508.67 g/mol. Its IUPAC name is 1-N-[2-(2,3-dihydro-1,4-benzodioxin-6-ylmethylsulfanyl)ethyl]-1-N'-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethyl]-2-nitroethene-1,1-diamine.
| Compound Name | 1-N-[2-(2,3-dihydro-1,4-benzodioxin-6-ylmethylsulfanyl)ethyl]-1-N'-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethyl]-2-nitroethene-1,1-diamine |
|---|---|
| PubChem CID | 70430247 |
| Molecular Formula | C23H32N4O5S2 |
| Molecular Weight | 508.67 g/mol |
| Exact Mass | 508.18 |
| IUPAC Name | 1-N-[2-(2,3-dihydro-1,4-benzodioxin-6-ylmethylsulfanyl)ethyl]-1-N'-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethyl]-2-nitroethene-1,1-diamine |
| SMILES | CN(C)Cc1ccc(CSCCNC(=C[N+](=O)[O-])NCCSCc2ccc3c(c2)OCCO3)o1 |
| InChI | InChI=1S/C23H32N4O5S2/c1-26(2)14-19-4-5-20(32-19)17-34-12-8-25-23(15-27(28)29)24-7-11-33-16-18-3-6-21-22(13-18)31-10-9-30-21/h3-6,13,15,24-25H,7-12,14,16-17H2,1-2H3 |
| InChIKey | RIIIEOAKMYTDCM-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 102.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.67 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|