C11H14N3O5S- — CID 139594610
5-[2-[[(E)-1-(methylamino)-2-nitroethenyl]amino]ethylsulfanylmethyl]furan-2-carboxylate (PubChem CID 139594610) has the molecular formula C11H14N3O5S- and a molecular weight of 300.32 g/mol. Its IUPAC name is 5-[2-[[(E)-1-(methylamino)-2-nitroethenyl]amino]ethylsulfanylmethyl]furan-2-carboxylate.
| Compound Name | 5-[2-[[(E)-1-(methylamino)-2-nitroethenyl]amino]ethylsulfanylmethyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 139594610 |
| Molecular Formula | C11H14N3O5S- |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | 5-[2-[[(E)-1-(methylamino)-2-nitroethenyl]amino]ethylsulfanylmethyl]furan-2-carboxylate |
| SMILES | CN/C(=C\[N+](=O)[O-])NCCSCc1ccc(C(=O)[O-])o1 |
| InChI | InChI=1S/C11H15N3O5S/c1-12-10(6-14(17)18)13-4-5-20-7-8-2-3-9(19-8)11(15)16/h2-3,6,12-13H,4-5,7H2,1H3,(H,15,16)/p-1/b10-6+ |
| InChIKey | CSBKVBOESJZNHL-UXBLZVDNSA-M |
| XLogP | -0.24 |
| TPSA | 120.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|