C17H26BiN4O9S+ — CID 19379519
bismuth;2,3-dihydroxybutanedioate;(Z)-1-N'-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethyl]-1-N-methyl-2-nitroethene-1,1-diamine (PubChem CID 19379519) has the molecular formula C17H26BiN4O9S+ and a molecular weight of 671.46 g/mol. Its IUPAC name is bismuth;2,3-dihydroxybutanedioate;(Z)-1-N'-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethyl]-1-N-methyl-2-nitroethene-1,1-diamine.
| Compound Name | bismuth;2,3-dihydroxybutanedioate;(Z)-1-N'-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethyl]-1-N-methyl-2-nitroethene-1,1-diamine |
|---|---|
| PubChem CID | 19379519 |
| Molecular Formula | C17H26BiN4O9S+ |
| Molecular Weight | 671.46 g/mol |
| Exact Mass | 671.12 |
| IUPAC Name | bismuth;2,3-dihydroxybutanedioate;(Z)-1-N'-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethyl]-1-N-methyl-2-nitroethene-1,1-diamine |
| SMILES | CN/C(=C/[N+](=O)[O-])NCCSCc1ccc(CN(C)C)o1.O=C([O-])C(O)C(O)C(=O)[O-].[Bi+3] |
| InChI | InChI=1S/C13H22N4O3S.C4H6O6.Bi/c1-14-13(9-17(18)19)15-6-7-21-10-12-5-4-11(20-12)8-16(2)3;5-1(3(7)8)2(6)4(9)10;/h4-5,9,14-15H,6-8,10H2,1-3H3;1-2,5-6H,(H,7,8)(H,9,10);/q;;+3/p-2/b13-9-;; |
| InChIKey | XRBCLGVUMSWBQG-WOAHMTPUSA-L |
| XLogP | -3.71 |
| TPSA | 204.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.46 |
| LogP ≤ 5 | -3.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|