C18H27N5O6S — CID 59880366
4-methyl-1-[methyl-[[5-[2-[[(Z)-1-(methylamino)-2-nitroethenyl]amino]ethylsulfanylmethyl]furan-2-yl]methyl]amino]-4-nitrosopentane-2,3-dione (PubChem CID 59880366) has the molecular formula C18H27N5O6S and a molecular weight of 441.51 g/mol. Its IUPAC name is 4-methyl-1-[methyl-[[5-[2-[[(Z)-1-(methylamino)-2-nitroethenyl]amino]ethylsulfanylmethyl]furan-2-yl]methyl]amino]-4-nitrosopentane-2,3-dione.
| Compound Name | 4-methyl-1-[methyl-[[5-[2-[[(Z)-1-(methylamino)-2-nitroethenyl]amino]ethylsulfanylmethyl]furan-2-yl]methyl]amino]-4-nitrosopentane-2,3-dione |
|---|---|
| PubChem CID | 59880366 |
| Molecular Formula | C18H27N5O6S |
| Molecular Weight | 441.51 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | 4-methyl-1-[methyl-[[5-[2-[[(Z)-1-(methylamino)-2-nitroethenyl]amino]ethylsulfanylmethyl]furan-2-yl]methyl]amino]-4-nitrosopentane-2,3-dione |
| SMILES | CN/C(=C/[N+](=O)[O-])NCCSCc1ccc(CN(C)CC(=O)C(=O)C(C)(C)N=O)o1 |
| InChI | InChI=1S/C18H27N5O6S/c1-18(2,21-26)17(25)15(24)10-22(4)9-13-5-6-14(29-13)12-30-8-7-20-16(19-3)11-23(27)28/h5-6,11,19-20H,7-10,12H2,1-4H3/b16-11- |
| InChIKey | MIWCGLXUHFSMLR-WJDWOHSUSA-N |
| XLogP | 1.51 |
| TPSA | 147.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.51 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|