C12H19N5O4S — CID 175674039
N-methyl-N-[[5-[2-[[1-(methylamino)-2-nitroethenyl]amino]ethylsulfanylmethyl]furan-2-yl]methyl]nitrous amide (PubChem CID 175674039) has the molecular formula C12H19N5O4S and a molecular weight of 329.38 g/mol. Its IUPAC name is N-methyl-N-[[5-[2-[[1-(methylamino)-2-nitroethenyl]amino]ethylsulfanylmethyl]furan-2-yl]methyl]nitrous amide.
| Compound Name | N-methyl-N-[[5-[2-[[1-(methylamino)-2-nitroethenyl]amino]ethylsulfanylmethyl]furan-2-yl]methyl]nitrous amide |
|---|---|
| PubChem CID | 175674039 |
| Molecular Formula | C12H19N5O4S |
| Molecular Weight | 329.38 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | N-methyl-N-[[5-[2-[[1-(methylamino)-2-nitroethenyl]amino]ethylsulfanylmethyl]furan-2-yl]methyl]nitrous amide |
| SMILES | CNC(=C[N+](=O)[O-])NCCSCc1ccc(CN(C)N=O)o1 |
| InChI | InChI=1S/C12H19N5O4S/c1-13-12(8-17(19)20)14-5-6-22-9-11-4-3-10(21-11)7-16(2)15-18/h3-4,8,13-14H,5-7,9H2,1-2H3 |
| InChIKey | QKZPWYWIGNQSMX-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.38 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|