C15H26CaN4O5S+2 — CID 173157323
calcium;acetic acid;(Z)-1-N'-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethyl]-1-N-methyl-2-nitroethene-1,1-diamine (PubChem CID 173157323) has the molecular formula C15H26CaN4O5S+2 and a molecular weight of 414.54 g/mol. Its IUPAC name is calcium;acetic acid;(Z)-1-N'-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethyl]-1-N-methyl-2-nitroethene-1,1-diamine.
| Compound Name | calcium;acetic acid;(Z)-1-N'-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethyl]-1-N-methyl-2-nitroethene-1,1-diamine |
|---|---|
| PubChem CID | 173157323 |
| Molecular Formula | C15H26CaN4O5S+2 |
| Molecular Weight | 414.54 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | calcium;acetic acid;(Z)-1-N'-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethyl]-1-N-methyl-2-nitroethene-1,1-diamine |
| SMILES | CC(=O)O.CN/C(=C/[N+](=O)[O-])NCCSCc1ccc(CN(C)C)o1.[Ca+2] |
| InChI | InChI=1S/C13H22N4O3S.C2H4O2.Ca/c1-14-13(9-17(18)19)15-6-7-21-10-12-5-4-11(20-12)8-16(2)3;1-2(3)4;/h4-5,9,14-15H,6-8,10H2,1-3H3;1H3,(H,3,4);/q;;+2/b13-9-;; |
| InChIKey | QFSOXRMMSBXRFT-WOAHMTPUSA-N |
| XLogP | 1.17 |
| TPSA | 120.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.54 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|