C20H29N5O7S — CID 73458377
4-methyl-1-[methyl-[[5-[2-[[1-(methylamino)-2-nitroethenyl]amino]ethylsulfanylmethyl]furan-2-yl]methyl]amino]-4-nitrosoheptane-2,3,5-trione (PubChem CID 73458377) has the molecular formula C20H29N5O7S and a molecular weight of 483.55 g/mol. Its IUPAC name is 4-methyl-1-[methyl-[[5-[2-[[1-(methylamino)-2-nitroethenyl]amino]ethylsulfanylmethyl]furan-2-yl]methyl]amino]-4-nitrosoheptane-2,3,5-trione.
| Compound Name | 4-methyl-1-[methyl-[[5-[2-[[1-(methylamino)-2-nitroethenyl]amino]ethylsulfanylmethyl]furan-2-yl]methyl]amino]-4-nitrosoheptane-2,3,5-trione |
|---|---|
| PubChem CID | 73458377 |
| Molecular Formula | C20H29N5O7S |
| Molecular Weight | 483.55 g/mol |
| Exact Mass | 483.18 |
| IUPAC Name | 4-methyl-1-[methyl-[[5-[2-[[1-(methylamino)-2-nitroethenyl]amino]ethylsulfanylmethyl]furan-2-yl]methyl]amino]-4-nitrosoheptane-2,3,5-trione |
| SMILES | CCC(=O)C(C)(N=O)C(=O)C(=O)CN(C)Cc1ccc(CSCCNC(=C[N+](=O)[O-])NC)o1 |
| InChI | InChI=1S/C20H29N5O7S/c1-5-17(27)20(2,23-29)19(28)16(26)11-24(4)10-14-6-7-15(32-14)13-33-9-8-22-18(21-3)12-25(30)31/h6-7,12,21-22H,5,8-11,13H2,1-4H3 |
| InChIKey | VWSKVRDOQWOFHR-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 164.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.55 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|