C13H21N3O3S2 — CID 70514260
N,N,4-trimethyl-5-[2-[(1-methylsulfanyl-2-nitroethenyl)amino]ethylsulfanylmethyl]furan-2-amine (PubChem CID 70514260) has the molecular formula C13H21N3O3S2 and a molecular weight of 331.46 g/mol. Its IUPAC name is N,N,4-trimethyl-5-[2-[(1-methylsulfanyl-2-nitroethenyl)amino]ethylsulfanylmethyl]furan-2-amine.
| Compound Name | N,N,4-trimethyl-5-[2-[(1-methylsulfanyl-2-nitroethenyl)amino]ethylsulfanylmethyl]furan-2-amine |
|---|---|
| PubChem CID | 70514260 |
| Molecular Formula | C13H21N3O3S2 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | N,N,4-trimethyl-5-[2-[(1-methylsulfanyl-2-nitroethenyl)amino]ethylsulfanylmethyl]furan-2-amine |
| SMILES | CSC(=C[N+](=O)[O-])NCCSCc1oc(N(C)C)cc1C |
| InChI | InChI=1S/C13H21N3O3S2/c1-10-7-13(15(2)3)19-11(10)9-21-6-5-14-12(20-4)8-16(17)18/h7-8,14H,5-6,9H2,1-4H3 |
| InChIKey | HEBUQMCLKGGCLR-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 71.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|