C18H24N4O3S — CID 20570917
(E)-1-N-methyl-1-N'-[2-[[5-(methylaminomethyl)-4-phenylfuran-2-yl]methylsulfanyl]ethyl]-2-nitroethene-1,1-diamine (PubChem CID 20570917) has the molecular formula C18H24N4O3S and a molecular weight of 376.48 g/mol. Its IUPAC name is (E)-1-N-methyl-1-N'-[2-[[5-(methylaminomethyl)-4-phenylfuran-2-yl]methylsulfanyl]ethyl]-2-nitroethene-1,1-diamine.
| Compound Name | (E)-1-N-methyl-1-N'-[2-[[5-(methylaminomethyl)-4-phenylfuran-2-yl]methylsulfanyl]ethyl]-2-nitroethene-1,1-diamine |
|---|---|
| PubChem CID | 20570917 |
| Molecular Formula | C18H24N4O3S |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | (E)-1-N-methyl-1-N'-[2-[[5-(methylaminomethyl)-4-phenylfuran-2-yl]methylsulfanyl]ethyl]-2-nitroethene-1,1-diamine |
| SMILES | CNCc1oc(CSCCN/C(=C/[N+](=O)[O-])NC)cc1-c1ccccc1 |
| InChI | InChI=1S/C18H24N4O3S/c1-19-11-17-16(14-6-4-3-5-7-14)10-15(25-17)13-26-9-8-21-18(20-2)12-22(23)24/h3-7,10,12,19-21H,8-9,11,13H2,1-2H3/b18-12+ |
| InChIKey | ADBNTICZPOMGIA-LDADJPATSA-N |
| XLogP | 2.78 |
| TPSA | 92.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|