C15H26N4O4S — CID 56979257
N'-[2-[[5-[(dimethylamino)methyl]-4-(methoxymethyl)furan-2-yl]methylsulfanyl]ethyl]-2-nitropropanimidamide (PubChem CID 56979257) has the molecular formula C15H26N4O4S and a molecular weight of 358.46 g/mol. Its IUPAC name is N'-[2-[[5-[(dimethylamino)methyl]-4-(methoxymethyl)furan-2-yl]methylsulfanyl]ethyl]-2-nitropropanimidamide.
| Compound Name | N'-[2-[[5-[(dimethylamino)methyl]-4-(methoxymethyl)furan-2-yl]methylsulfanyl]ethyl]-2-nitropropanimidamide |
|---|---|
| PubChem CID | 56979257 |
| Molecular Formula | C15H26N4O4S |
| Molecular Weight | 358.46 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | N'-[2-[[5-[(dimethylamino)methyl]-4-(methoxymethyl)furan-2-yl]methylsulfanyl]ethyl]-2-nitropropanimidamide |
| SMILES | COCc1cc(CSCC/N=C(\N)C(C)[N+](=O)[O-])oc1CN(C)C |
| InChI | InChI=1S/C15H26N4O4S/c1-11(19(20)21)15(16)17-5-6-24-10-13-7-12(9-22-4)14(23-13)8-18(2)3/h7,11H,5-6,8-10H2,1-4H3,(H2,16,17) |
| InChIKey | FOLXJYCMXYBNIK-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 107.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.46 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|